C11H17ClN2O2 — CID 105128169
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-4-ethoxybutan-2-one (PubChem CID 105128169) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-4-ethoxybutan-2-one.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-4-ethoxybutan-2-one |
|---|---|
| PubChem CID | 105128169 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-4-ethoxybutan-2-one |
| SMILES | CCOCCC(=O)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C11H17ClN2O2/c1-4-16-6-5-9(15)7-10-8(2)13-14(3)11(10)12/h4-7H2,1-3H3 |
| InChIKey | XMCPFSZLFHEDPH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|