C8H13ClN2O — CID 60796732
5-chloro-4-(ethoxymethyl)-1,3-dimethylpyrazole (PubChem CID 60796732) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is 5-chloro-4-(ethoxymethyl)-1,3-dimethylpyrazole.
| Compound Name | 5-chloro-4-(ethoxymethyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 60796732 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 5-chloro-4-(ethoxymethyl)-1,3-dimethylpyrazole |
| SMILES | CCOCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C8H13ClN2O/c1-4-12-5-7-6(2)10-11(3)8(7)9/h4-5H2,1-3H3 |
| InChIKey | UDRAXYLOXXXBOY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |