C12H21ClN2O2 — CID 116711010
1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethoxypentan-2-ol (PubChem CID 116711010) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethoxypentan-2-ol.
| Compound Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethoxypentan-2-ol |
|---|---|
| PubChem CID | 116711010 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethoxypentan-2-ol |
| SMILES | CCOC(CC)C(O)Cc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C12H21ClN2O2/c1-5-11(17-6-2)10(16)7-9-8(3)14-15(4)12(9)13/h10-11,16H,5-7H2,1-4H3 |
| InChIKey | GTWQSUJTYAPDHS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |