C17H25ClN2O — CID 115832340
1-(2-adamantyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)ethanol (PubChem CID 115832340) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)ethanol.
| Compound Name | 1-(2-adamantyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 115832340 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-(2-adamantyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)c(Cl)c1CC(O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H25ClN2O/c1-9-14(17(18)20(2)19-9)8-15(21)16-12-4-10-3-11(6-12)7-13(16)5-10/h10-13,15-16,21H,3-8H2,1-2H3 |
| InChIKey | LAAZVWVBHISHKO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |