C10H10F3N3O — CID 116572790
pyrimidin-5-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 116572790) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is pyrimidin-5-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | pyrimidin-5-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 116572790 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | pyrimidin-5-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | O=C(c1cncnc1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)9(1-2-14-5-9)8(17)7-3-15-6-16-4-7/h3-4,6,14H,1-2,5H2 |
| InChIKey | QMZFTEALRHBCSU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |