C14H16F3NO2 — CID 116572885
(4-methoxy-2-methylphenyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 116572885) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (4-methoxy-2-methylphenyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | (4-methoxy-2-methylphenyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 116572885 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (4-methoxy-2-methylphenyl)-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | COc1ccc(C(=O)C2(C(F)(F)F)CCNC2)c(C)c1 |
| InChI | InChI=1S/C14H16F3NO2/c1-9-7-10(20-2)3-4-11(9)12(19)13(14(15,16)17)5-6-18-8-13/h3-4,7,18H,5-6,8H2,1-2H3 |
| InChIKey | GRCXJCKVHCRCQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |