C18H19NO — CID 116573122
6-azaspiro[2.5]octan-2-yl(naphthalen-2-yl)methanone (PubChem CID 116573122) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-azaspiro[2.5]octan-2-yl(naphthalen-2-yl)methanone.
| Compound Name | 6-azaspiro[2.5]octan-2-yl(naphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 116573122 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-azaspiro[2.5]octan-2-yl(naphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2ccccc2c1)C1CC12CCNCC2 |
| InChI | InChI=1S/C18H19NO/c20-17(16-12-18(16)7-9-19-10-8-18)15-6-5-13-3-1-2-4-14(13)11-15/h1-6,11,16,19H,7-10,12H2 |
| InChIKey | LKTVWWZYQODTEW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |