C41H39N5O6 — CID 11657690
3-N,5-N-bis[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 11657690) has the molecular formula C41H39N5O6 and a molecular weight of 697.79 g/mol. Its IUPAC name is 3-N,5-N-bis[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 11657690 |
| Molecular Formula | C41H39N5O6 |
| Molecular Weight | 697.79 g/mol |
| Exact Mass | 697.29 |
| IUPAC Name | 3-N,5-N-bis[5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | COc1ccc(/C=C/c2onc(C)c2NC(=O)C2=C(C)NC(C)=C(C(=O)Nc3c(C)noc3/C=C/c3ccc(OC)cc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C41H39N5O6/c1-24-35(40(47)43-38-26(3)45-51-33(38)22-16-28-12-18-31(49-5)19-13-28)37(30-10-8-7-9-11-30)36(25(2)42-24)41(48)44-39-27(4)46-52-34(39)23-17-29-14-20-32(50-6)21-15-29/h7-23,37,42H,1-6H3,(H,43,47)(H,44,48)/b22-16+,23-17+ |
| InChIKey | YVWYJYWCCOIXTN-LKNRODPVSA-N |
| XLogP | 8.15 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.79 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |