C17H26FNO — CID 116578361
5-(2-aminoethyl)-1-(3-fluorophenyl)-6,6-dimethylheptan-2-one (PubChem CID 116578361) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-(3-fluorophenyl)-6,6-dimethylheptan-2-one.
| Compound Name | 5-(2-aminoethyl)-1-(3-fluorophenyl)-6,6-dimethylheptan-2-one |
|---|---|
| PubChem CID | 116578361 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 5-(2-aminoethyl)-1-(3-fluorophenyl)-6,6-dimethylheptan-2-one |
| SMILES | CC(C)(C)C(CCN)CCC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H26FNO/c1-17(2,3)14(9-10-19)7-8-16(20)12-13-5-4-6-15(18)11-13/h4-6,11,14H,7-10,12,19H2,1-3H3 |
| InChIKey | KYQSOGQEJJJNSS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |