C11H14BrNOS — CID 116580567
2-(3-bromothiophen-2-yl)-1-(2-methylpyrrolidin-2-yl)ethanone (PubChem CID 116580567) has the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(2-methylpyrrolidin-2-yl)ethanone.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(2-methylpyrrolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 116580567 |
| Molecular Formula | C11H14BrNOS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(2-methylpyrrolidin-2-yl)ethanone |
| SMILES | CC1(C(=O)Cc2sccc2Br)CCCN1 |
| InChI | InChI=1S/C11H14BrNOS/c1-11(4-2-5-13-11)10(14)7-9-8(12)3-6-15-9/h3,6,13H,2,4-5,7H2,1H3 |
| InChIKey | JXZDFGPSKQDNAW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |