C11H15NO2 — CID 116580591
2-(furan-3-yl)-1-(2-methylpyrrolidin-2-yl)ethanone (PubChem CID 116580591) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-(2-methylpyrrolidin-2-yl)ethanone.
| Compound Name | 2-(furan-3-yl)-1-(2-methylpyrrolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 116580591 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(furan-3-yl)-1-(2-methylpyrrolidin-2-yl)ethanone |
| SMILES | CC1(C(=O)Cc2ccoc2)CCCN1 |
| InChI | InChI=1S/C11H15NO2/c1-11(4-2-5-12-11)10(13)7-9-3-6-14-8-9/h3,6,8,12H,2,4-5,7H2,1H3 |
| InChIKey | VJQYIQBBVCIEED-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |