C10H13NO3 — CID 116579682
1-(3-aminooxolan-3-yl)-2-(furan-3-yl)ethanone (PubChem CID 116579682) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(3-aminooxolan-3-yl)-2-(furan-3-yl)ethanone.
| Compound Name | 1-(3-aminooxolan-3-yl)-2-(furan-3-yl)ethanone |
|---|---|
| PubChem CID | 116579682 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1-(3-aminooxolan-3-yl)-2-(furan-3-yl)ethanone |
| SMILES | NC1(C(=O)Cc2ccoc2)CCOC1 |
| InChI | InChI=1S/C10H13NO3/c11-10(2-4-14-7-10)9(12)5-8-1-3-13-6-8/h1,3,6H,2,4-5,7,11H2 |
| InChIKey | HIWYVLJDLXEBSG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |