C8H12F3NO2 — CID 116579702
1-(3-aminooxolan-3-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 116579702) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 1-(3-aminooxolan-3-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(3-aminooxolan-3-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 116579702 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(3-aminooxolan-3-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | NC1(C(=O)CCC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)2-1-6(13)7(12)3-4-14-5-7/h1-5,12H2 |
| InChIKey | CVDARGTUZCHZKE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |