C10H16F3NO — CID 116550612
1-(1-aminocyclohexyl)-4,4,4-trifluorobutan-1-one (PubChem CID 116550612) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-(1-aminocyclohexyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(1-aminocyclohexyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 116550612 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(1-aminocyclohexyl)-4,4,4-trifluorobutan-1-one |
| SMILES | NC1(C(=O)CCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)7-4-8(15)9(14)5-2-1-3-6-9/h1-7,14H2 |
| InChIKey | ILWZTPRRLRJXAR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |