C11H18F3NO — CID 116579119
1-(1-aminocyclohexyl)-5,5,5-trifluoropentan-2-one (PubChem CID 116579119) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(1-aminocyclohexyl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(1-aminocyclohexyl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 116579119 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(1-aminocyclohexyl)-5,5,5-trifluoropentan-2-one |
| SMILES | NC1(CC(=O)CCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H18F3NO/c12-11(13,14)7-4-9(16)8-10(15)5-2-1-3-6-10/h1-8,15H2 |
| InChIKey | YRFWLYDKJKHWKI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |