C13H22F3NO — CID 116614424
1-[1-(aminomethyl)cyclohexyl]-6,6,6-trifluorohexan-2-one (PubChem CID 116614424) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclohexyl]-6,6,6-trifluorohexan-2-one.
| Compound Name | 1-[1-(aminomethyl)cyclohexyl]-6,6,6-trifluorohexan-2-one |
|---|---|
| PubChem CID | 116614424 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[1-(aminomethyl)cyclohexyl]-6,6,6-trifluorohexan-2-one |
| SMILES | NCC1(CC(=O)CCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C13H22F3NO/c14-13(15,16)8-4-5-11(18)9-12(10-17)6-2-1-3-7-12/h1-10,17H2 |
| InChIKey | CSFCFRJXPSTBGR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |