C10H20O — CID 11658324
(3S,4S)-2,2,3,4-tetramethylhex-5-en-3-ol (PubChem CID 11658324) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is (3S,4S)-2,2,3,4-tetramethylhex-5-en-3-ol.
| Compound Name | (3S,4S)-2,2,3,4-tetramethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 11658324 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (3S,4S)-2,2,3,4-tetramethylhex-5-en-3-ol |
| SMILES | C=C[C@H](C)[C@](C)(O)C(C)(C)C |
| InChI | InChI=1S/C10H20O/c1-7-8(2)10(6,11)9(3,4)5/h7-8,11H,1H2,2-6H3/t8-,10-/m0/s1 |
| InChIKey | RQIUIOOORQEPGL-WPRPVWTQSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|