C15H21NO2 — CID 116584506
1-[2-(aminomethyl)cyclohexyl]-2-(3-hydroxyphenyl)ethanone (PubChem CID 116584506) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[2-(aminomethyl)cyclohexyl]-2-(3-hydroxyphenyl)ethanone.
| Compound Name | 1-[2-(aminomethyl)cyclohexyl]-2-(3-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 116584506 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[2-(aminomethyl)cyclohexyl]-2-(3-hydroxyphenyl)ethanone |
| SMILES | NCC1CCCCC1C(=O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C15H21NO2/c16-10-12-5-1-2-7-14(12)15(18)9-11-4-3-6-13(17)8-11/h3-4,6,8,12,14,17H,1-2,5,7,9-10,16H2 |
| InChIKey | HJNJECRMMZEHDJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |