C15H19Cl2NO — CID 116584483
1-[2-(aminomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 116584483) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-[2-(aminomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[2-(aminomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 116584483 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[2-(aminomethyl)cyclohexyl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | NCC1CCCCC1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO/c16-13-6-5-10(7-14(13)17)8-15(19)12-4-2-1-3-11(12)9-18/h5-7,11-12H,1-4,8-9,18H2 |
| InChIKey | FUOCAMGPEZPOBK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |