C10H12N2OS — CID 116585557
1-[2-(2-aminoethyl)-1,3-thiazol-4-yl]pent-4-yn-1-one (PubChem CID 116585557) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-[2-(2-aminoethyl)-1,3-thiazol-4-yl]pent-4-yn-1-one.
| Compound Name | 1-[2-(2-aminoethyl)-1,3-thiazol-4-yl]pent-4-yn-1-one |
|---|---|
| PubChem CID | 116585557 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-[2-(2-aminoethyl)-1,3-thiazol-4-yl]pent-4-yn-1-one |
| SMILES | C#CCCC(=O)c1csc(CCN)n1 |
| InChI | InChI=1S/C10H12N2OS/c1-2-3-4-9(13)8-7-14-10(12-8)5-6-11/h1,7H,3-6,11H2 |
| InChIKey | ZAAFVCSVIXERFG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|