C13H17NO2 — CID 116588048
[4-(ethylamino)oxolan-3-yl]-phenylmethanone (PubChem CID 116588048) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is [4-(ethylamino)oxolan-3-yl]-phenylmethanone.
| Compound Name | [4-(ethylamino)oxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 116588048 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [4-(ethylamino)oxolan-3-yl]-phenylmethanone |
| SMILES | CCNC1COCC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-2-14-12-9-16-8-11(12)13(15)10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3 |
| InChIKey | MMUDXDWXQGQHOD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |