C13H17ClN2O2 — CID 66259041
N-(2-chlorophenyl)-4-(ethylamino)oxolane-3-carboxamide (PubChem CID 66259041) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(ethylamino)oxolane-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-(ethylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66259041 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(2-chlorophenyl)-4-(ethylamino)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN2O2/c1-2-15-12-8-18-7-9(12)13(17)16-11-6-4-3-5-10(11)14/h3-6,9,12,15H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | VMMXJJUZIZIXJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |