C12H14ClFN2O2 — CID 66266165
N-(3-chloro-2-fluorophenyl)-4-(methylamino)oxolane-3-carboxamide (PubChem CID 66266165) has the molecular formula C12H14ClFN2O2 and a molecular weight of 272.71 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-4-(methylamino)oxolane-3-carboxamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-4-(methylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66266165 |
| Molecular Formula | C12H14ClFN2O2 |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-4-(methylamino)oxolane-3-carboxamide |
| SMILES | CNC1COCC1C(=O)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H14ClFN2O2/c1-15-10-6-18-5-7(10)12(17)16-9-4-2-3-8(13)11(9)14/h2-4,7,10,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | UMSVNBDGVLNPHV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |