C14H18ClIN2O2 — CID 66254611
N-(2-chloro-4-iodophenyl)-4-(propylamino)oxolane-3-carboxamide (PubChem CID 66254611) has the molecular formula C14H18ClIN2O2 and a molecular weight of 408.67 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-4-(propylamino)oxolane-3-carboxamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-4-(propylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66254611 |
| Molecular Formula | C14H18ClIN2O2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-4-(propylamino)oxolane-3-carboxamide |
| SMILES | CCCNC1COCC1C(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C14H18ClIN2O2/c1-2-5-17-13-8-20-7-10(13)14(19)18-12-4-3-9(16)6-11(12)15/h3-4,6,10,13,17H,2,5,7-8H2,1H3,(H,18,19) |
| InChIKey | YKTHZKFKOQWCIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|