C11H9ClINO3 — CID 93366670
cis-(1S,2R)-2-[(2-chloro-4-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 93366670) has the molecular formula C11H9ClINO3 and a molecular weight of 365.55 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(2-chloro-4-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[(2-chloro-4-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 93366670 |
| Molecular Formula | C11H9ClINO3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | cis-(1S,2R)-2-[(2-chloro-4-iodophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H]1C(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H9ClINO3/c12-8-3-5(13)1-2-9(8)14-10(15)6-4-7(6)11(16)17/h1-3,6-7H,4H2,(H,14,15)(H,16,17)/t6-,7+/m1/s1 |
| InChIKey | UGPJXMNEKVYNIZ-RQJHMYQMSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|