C14H18F2N2O3 — CID 66257880
N-[2-(difluoromethoxy)phenyl]-4-(ethylamino)oxolane-3-carboxamide (PubChem CID 66257880) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-4-(ethylamino)oxolane-3-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-4-(ethylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66257880 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-4-(ethylamino)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H18F2N2O3/c1-2-17-11-8-20-7-9(11)13(19)18-10-5-3-4-6-12(10)21-14(15)16/h3-6,9,11,14,17H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | KTGMSOUFODFLDX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |