C14H19BrN2O2 — CID 107625139
N-(3-bromo-2-methylphenyl)-4-(ethylamino)oxolane-3-carboxamide (PubChem CID 107625139) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(3-bromo-2-methylphenyl)-4-(ethylamino)oxolane-3-carboxamide.
| Compound Name | N-(3-bromo-2-methylphenyl)-4-(ethylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 107625139 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(3-bromo-2-methylphenyl)-4-(ethylamino)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)Nc1cccc(Br)c1C |
| InChI | InChI=1S/C14H19BrN2O2/c1-3-16-13-8-19-7-10(13)14(18)17-12-6-4-5-11(15)9(12)2/h4-6,10,13,16H,3,7-8H2,1-2H3,(H,17,18) |
| InChIKey | XGLRXFKSPJLTJP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |