C13H15BrF2N2O2 — CID 102853704
N-(5-bromo-2,4-difluorophenyl)-4-(ethylamino)oxolane-3-carboxamide (PubChem CID 102853704) has the molecular formula C13H15BrF2N2O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-4-(ethylamino)oxolane-3-carboxamide.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-4-(ethylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 102853704 |
| Molecular Formula | C13H15BrF2N2O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-4-(ethylamino)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C13H15BrF2N2O2/c1-2-17-12-6-20-5-7(12)13(19)18-11-3-8(14)9(15)4-10(11)16/h3-4,7,12,17H,2,5-6H2,1H3,(H,18,19) |
| InChIKey | UUGCMMXEUJVMEM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|