C13H15BrClNO2 — CID 116589151
1-[5-(aminomethyl)oxolan-2-yl]-2-(4-bromo-2-chlorophenyl)ethanone (PubChem CID 116589151) has the molecular formula C13H15BrClNO2 and a molecular weight of 332.63 g/mol. Its IUPAC name is 1-[5-(aminomethyl)oxolan-2-yl]-2-(4-bromo-2-chlorophenyl)ethanone.
| Compound Name | 1-[5-(aminomethyl)oxolan-2-yl]-2-(4-bromo-2-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 116589151 |
| Molecular Formula | C13H15BrClNO2 |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 1-[5-(aminomethyl)oxolan-2-yl]-2-(4-bromo-2-chlorophenyl)ethanone |
| SMILES | NCC1CCC(C(=O)Cc2ccc(Br)cc2Cl)O1 |
| InChI | InChI=1S/C13H15BrClNO2/c14-9-2-1-8(11(15)6-9)5-12(17)13-4-3-10(7-16)18-13/h1-2,6,10,13H,3-5,7,16H2 |
| InChIKey | MUKCKQMXNZDKKY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |