C8H14N4O2 — CID 116591027
1-(2-aminoethoxy)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-one (PubChem CID 116591027) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-(2-aminoethoxy)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-one.
| Compound Name | 1-(2-aminoethoxy)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-one |
|---|---|
| PubChem CID | 116591027 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-(2-aminoethoxy)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-one |
| SMILES | Cn1ncnc1CC(=O)COCCN |
| InChI | InChI=1S/C8H14N4O2/c1-12-8(10-6-11-12)4-7(13)5-14-3-2-9/h6H,2-5,9H2,1H3 |
| InChIKey | JQIYSCFOIBTBJV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|