C9H16N4O — CID 116555705
5-(methylamino)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-2-one (PubChem CID 116555705) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-(methylamino)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-2-one.
| Compound Name | 5-(methylamino)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 116555705 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 5-(methylamino)-1-(2-methyl-1,2,4-triazol-3-yl)pentan-2-one |
| SMILES | CNCCCC(=O)Cc1ncnn1C |
| InChI | InChI=1S/C9H16N4O/c1-10-5-3-4-8(14)6-9-11-7-12-13(9)2/h7,10H,3-6H2,1-2H3 |
| InChIKey | NYLZTNUWWVSSNX-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|