C14H9FN2O4 — CID 11659260
3-(3-fluoro-4-hydroxyphenyl)-5,7-dihydroxyquinazolin-4-one (PubChem CID 11659260) has the molecular formula C14H9FN2O4 and a molecular weight of 288.23 g/mol. Its IUPAC name is 3-(3-fluoro-4-hydroxyphenyl)-5,7-dihydroxyquinazolin-4-one.
| Compound Name | 3-(3-fluoro-4-hydroxyphenyl)-5,7-dihydroxyquinazolin-4-one |
|---|---|
| PubChem CID | 11659260 |
| Molecular Formula | C14H9FN2O4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-(3-fluoro-4-hydroxyphenyl)-5,7-dihydroxyquinazolin-4-one |
| SMILES | O=c1c2c(O)cc(O)cc2ncn1-c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C14H9FN2O4/c15-9-3-7(1-2-11(9)19)17-6-16-10-4-8(18)5-12(20)13(10)14(17)21/h1-6,18-20H |
| InChIKey | SKWIAJGGJLIDEZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |