C9H15N2O6P — CID 11659295
[(2R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propan-2-yl]oxymethylphosphonic acid (PubChem CID 11659295) has the molecular formula C9H15N2O6P and a molecular weight of 278.20 g/mol. Its IUPAC name is [(2R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 11659295 |
| Molecular Formula | C9H15N2O6P |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | [(2R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propan-2-yl]oxymethylphosphonic acid |
| SMILES | Cc1cn(C[C@@H](C)OCP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N2O6P/c1-6-3-11(9(13)10-8(6)12)4-7(2)17-5-18(14,15)16/h3,7H,4-5H2,1-2H3,(H,10,12,13)(H2,14,15,16)/t7-/m1/s1 |
| InChIKey | XIZPVMOLDUEBMU-SSDOTTSWSA-N |
| XLogP | -0.61 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|