C13H14F3NO — CID 116593583
1-(2,3-dihydro-1H-indol-3-yl)-5,5,5-trifluoropentan-2-one (PubChem CID 116593583) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-3-yl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(2,3-dihydro-1H-indol-3-yl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 116593583 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-3-yl)-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)CC1CNc2ccccc21 |
| InChI | InChI=1S/C13H14F3NO/c14-13(15,16)6-5-10(18)7-9-8-17-12-4-2-1-3-11(9)12/h1-4,9,17H,5-8H2 |
| InChIKey | RRMDMTIPHBQWGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |