C15H21N3O — CID 80573143
1-(1,4-diazepan-1-yl)-2-(2,3-dihydro-1H-indol-3-yl)ethanone (PubChem CID 80573143) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(2,3-dihydro-1H-indol-3-yl)ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(2,3-dihydro-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 80573143 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(2,3-dihydro-1H-indol-3-yl)ethanone |
| SMILES | O=C(CC1CNc2ccccc21)N1CCCNCC1 |
| InChI | InChI=1S/C15H21N3O/c19-15(18-8-3-6-16-7-9-18)10-12-11-17-14-5-2-1-4-13(12)14/h1-2,4-5,12,16-17H,3,6-11H2 |
| InChIKey | WXLHSYHTDWRAMN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |