C12H25NO — CID 116597857
4-(aminomethyl)-2,7-dimethylnonan-5-one (PubChem CID 116597857) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-(aminomethyl)-2,7-dimethylnonan-5-one.
| Compound Name | 4-(aminomethyl)-2,7-dimethylnonan-5-one |
|---|---|
| PubChem CID | 116597857 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-(aminomethyl)-2,7-dimethylnonan-5-one |
| SMILES | CCC(C)CC(=O)C(CN)CC(C)C |
| InChI | InChI=1S/C12H25NO/c1-5-10(4)7-12(14)11(8-13)6-9(2)3/h9-11H,5-8,13H2,1-4H3 |
| InChIKey | IUMHRIMSKRLSFN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |