C13H27NO — CID 116576821
7-(aminomethyl)-3,9-dimethyldecan-5-one (PubChem CID 116576821) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 7-(aminomethyl)-3,9-dimethyldecan-5-one.
| Compound Name | 7-(aminomethyl)-3,9-dimethyldecan-5-one |
|---|---|
| PubChem CID | 116576821 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 7-(aminomethyl)-3,9-dimethyldecan-5-one |
| SMILES | CCC(C)CC(=O)CC(CN)CC(C)C |
| InChI | InChI=1S/C13H27NO/c1-5-11(4)7-13(15)8-12(9-14)6-10(2)3/h10-12H,5-9,14H2,1-4H3 |
| InChIKey | NCVDHAKPRPJERF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |