C20H36N2O2 — CID 11660072
2,2-dimethyl-N-(3-oxo-2-azabicyclo[2.2.2]octan-4-yl)undecanamide (PubChem CID 11660072) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-oxo-2-azabicyclo[2.2.2]octan-4-yl)undecanamide.
| Compound Name | 2,2-dimethyl-N-(3-oxo-2-azabicyclo[2.2.2]octan-4-yl)undecanamide |
|---|---|
| PubChem CID | 11660072 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 2,2-dimethyl-N-(3-oxo-2-azabicyclo[2.2.2]octan-4-yl)undecanamide |
| SMILES | CCCCCCCCCC(C)(C)C(=O)NC12CCC(CC1)NC2=O |
| InChI | InChI=1S/C20H36N2O2/c1-4-5-6-7-8-9-10-13-19(2,3)17(23)22-20-14-11-16(12-15-20)21-18(20)24/h16H,4-15H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | UWBRTQAGMFVBNK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|