C12H24NO2- — CID 141061443
2,2-dimethyl-N-oxidodecanamide (PubChem CID 141061443) has the molecular formula C12H24NO2- and a molecular weight of 214.33 g/mol. Its IUPAC name is 2,2-dimethyl-N-oxidodecanamide.
| Compound Name | 2,2-dimethyl-N-oxidodecanamide |
|---|---|
| PubChem CID | 141061443 |
| Molecular Formula | C12H24NO2- |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,2-dimethyl-N-oxidodecanamide |
| SMILES | CCCCCCCCC(C)(C)C(=O)N[O-] |
| InChI | InChI=1S/C12H24NO2/c1-4-5-6-7-8-9-10-12(2,3)11(14)13-15/h4-10H2,1-3H3,(H-,13,14,15)/q-1 |
| InChIKey | HZXCYBFMBOLUBT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|