About 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one
1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one (PubChem CID 116601651) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one.
Molecular Properties
| Compound Name | 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one |
| PubChem CID | 116601651 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one |
| SMILES | Cn1ncnc1CC(=O)C(N)c1cccs1 |
| InChI | InChI=1S/C10H12N4OS/c1-14-9(12-6-13-14)5-7(15)10(11)8-3-2-4-16-8/h2-4,6,10H,5,11H2,1H3 |
| InChIKey | UNXOQFAKWFVJMJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one?
The IUPAC name of 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one (CID 116601651) is 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one.
What is the SMILES notation for 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one?
The canonical SMILES for 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one is Cn1ncnc1CC(=O)C(N)c1cccs1.
What is the InChIKey of 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one?
The InChIKey is UNXOQFAKWFVJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-14-9(12-6-13-14)5-7(15)10(11)8-3-2-4-16-8/h2-4,6,10H,5,11H2,1H3.
What are the key properties of 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one?
1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one has a molecular weight of 236.30 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2-methyl-1,2,4-triazol-3-yl)-1-thiophen-2-ylpropan-2-one is sourced from PubChem (CID 116601651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).