C15H11BrN2O3 — CID 11660254
7-bromo-2-(4-nitrophenyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 11660254) has the molecular formula C15H11BrN2O3 and a molecular weight of 347.17 g/mol. Its IUPAC name is 7-bromo-2-(4-nitrophenyl)-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | 7-bromo-2-(4-nitrophenyl)-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 11660254 |
| Molecular Formula | C15H11BrN2O3 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 7-bromo-2-(4-nitrophenyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1CC(c2ccc([N+](=O)[O-])cc2)Nc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H11BrN2O3/c16-10-3-6-12-14(7-10)17-13(8-15(12)19)9-1-4-11(5-2-9)18(20)21/h1-7,13,17H,8H2 |
| InChIKey | MQEBXLMQNILUQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|