C11H16N2O2S — CID 116604713
1-(4-aminooxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone (PubChem CID 116604713) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(4-aminooxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(4-aminooxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116604713 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(4-aminooxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1csc(CC(=O)C2(N)CCOCC2)n1 |
| InChI | InChI=1S/C11H16N2O2S/c1-8-7-16-10(13-8)6-9(14)11(12)2-4-15-5-3-11/h7H,2-6,12H2,1H3 |
| InChIKey | VYXUCXGUQDSSEM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |