C13H14FNO2 — CID 116606481
3-amino-1-(3-fluoro-4-methoxyphenyl)hex-5-yn-2-one (PubChem CID 116606481) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-amino-1-(3-fluoro-4-methoxyphenyl)hex-5-yn-2-one.
| Compound Name | 3-amino-1-(3-fluoro-4-methoxyphenyl)hex-5-yn-2-one |
|---|---|
| PubChem CID | 116606481 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-amino-1-(3-fluoro-4-methoxyphenyl)hex-5-yn-2-one |
| SMILES | C#CCC(N)C(=O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H14FNO2/c1-3-4-11(15)12(16)8-9-5-6-13(17-2)10(14)7-9/h1,5-7,11H,4,8,15H2,2H3 |
| InChIKey | DILAISXCKRGEIK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|