C20H21N3O3S — CID 11660956
2-(3-methylphenoxy)ethyl (E)-2-cyano-3-methylsulfanyl-3-(pyridin-3-ylmethylamino)prop-2-enoate (PubChem CID 11660956) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl (E)-2-cyano-3-methylsulfanyl-3-(pyridin-3-ylmethylamino)prop-2-enoate.
| Compound Name | 2-(3-methylphenoxy)ethyl (E)-2-cyano-3-methylsulfanyl-3-(pyridin-3-ylmethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 11660956 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl (E)-2-cyano-3-methylsulfanyl-3-(pyridin-3-ylmethylamino)prop-2-enoate |
| SMILES | CS/C(NCc1cccnc1)=C(\C#N)C(=O)OCCOc1cccc(C)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-15-5-3-7-17(11-15)25-9-10-26-20(24)18(12-21)19(27-2)23-14-16-6-4-8-22-13-16/h3-8,11,13,23H,9-10,14H2,1-2H3/b19-18+ |
| InChIKey | OCJKRYANKURQKY-VHEBQXMUSA-N |
| XLogP | 3.20 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|