C15H13N3OS2 — CID 3562008
3-methylsulfanyl-3-(pyridin-3-ylmethylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile (PubChem CID 3562008) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-methylsulfanyl-3-(pyridin-3-ylmethylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile.
| Compound Name | 3-methylsulfanyl-3-(pyridin-3-ylmethylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3562008 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-methylsulfanyl-3-(pyridin-3-ylmethylamino)-2-(thiophene-2-carbonyl)prop-2-enenitrile |
| SMILES | CSC(NCc1cccnc1)=C(C#N)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H13N3OS2/c1-20-15(18-10-11-4-2-6-17-9-11)12(8-16)14(19)13-5-3-7-21-13/h2-7,9,18H,10H2,1H3 |
| InChIKey | WYTIRQYXHKOLAN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|