C13H15N3O3S2 — CID 44995257
N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]thiophene-2-carboxamide (PubChem CID 44995257) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44995257 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[2-(pyridin-3-ylmethylsulfamoyl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)NCc1cccnc1)c1cccs1 |
| InChI | InChI=1S/C13H15N3O3S2/c17-13(12-4-2-7-20-12)15-6-8-21(18,19)16-10-11-3-1-5-14-9-11/h1-5,7,9,16H,6,8,10H2,(H,15,17) |
| InChIKey | BRZXSWKXZDUVOM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |