C11H7Cl2NO2 — CID 116609945
(4-amino-3,5-dichlorophenyl)-(furan-2-yl)methanone (PubChem CID 116609945) has the molecular formula C11H7Cl2NO2 and a molecular weight of 256.09 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(furan-2-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 116609945 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(furan-2-yl)methanone |
| SMILES | Nc1c(Cl)cc(C(=O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C11H7Cl2NO2/c12-7-4-6(5-8(13)10(7)14)11(15)9-2-1-3-16-9/h1-5H,14H2 |
| InChIKey | IHUAWKCQKANVQX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|