C18H19NO2 — CID 116611885
2,3-dihydro-1H-indol-6-yl-(2-propoxyphenyl)methanone (PubChem CID 116611885) has the molecular formula C18H19NO2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-6-yl-(2-propoxyphenyl)methanone.
| Compound Name | 2,3-dihydro-1H-indol-6-yl-(2-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 116611885 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2,3-dihydro-1H-indol-6-yl-(2-propoxyphenyl)methanone |
| SMILES | CCCOc1ccccc1C(=O)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C18H19NO2/c1-2-11-21-17-6-4-3-5-15(17)18(20)14-8-7-13-9-10-19-16(13)12-14/h3-8,12,19H,2,9-11H2,1H3 |
| InChIKey | DHBLHFSLBRBPMN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |