C18H19NO2 — CID 116554090
2,3-dihydro-1H-indol-5-yl-(2-propan-2-yloxyphenyl)methanone (PubChem CID 116554090) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-5-yl-(2-propan-2-yloxyphenyl)methanone.
| Compound Name | 2,3-dihydro-1H-indol-5-yl-(2-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 116554090 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2,3-dihydro-1H-indol-5-yl-(2-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccccc1C(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C18H19NO2/c1-12(2)21-17-6-4-3-5-15(17)18(20)14-7-8-16-13(11-14)9-10-19-16/h3-8,11-12,19H,9-10H2,1-2H3 |
| InChIKey | RTVWSAQNEBWJJF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |