C22H21N5O3 — CID 11661346
N-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,4-diazepane-1-carboxamide (PubChem CID 11661346) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 11661346 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[2,3-bis(furan-2-yl)quinoxalin-6-yl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1)N1CCCNCC1 |
| InChI | InChI=1S/C22H21N5O3/c28-22(27-10-3-8-23-9-11-27)24-15-6-7-16-17(14-15)26-21(19-5-2-13-30-19)20(25-16)18-4-1-12-29-18/h1-2,4-7,12-14,23H,3,8-11H2,(H,24,28) |
| InChIKey | UIWWMECROIYJTC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |